C21H15ClN4OS — CID 145495864
4-[[3-[(4-chlorophenyl)sulfanylamino]quinoxalin-2-yl]amino]benzaldehyde (PubChem CID 145495864) has the molecular formula C21H15ClN4OS and a molecular weight of 406.90 g/mol. Its IUPAC name is 4-[[3-[(4-chlorophenyl)sulfanylamino]quinoxalin-2-yl]amino]benzaldehyde.
| Compound Name | 4-[[3-[(4-chlorophenyl)sulfanylamino]quinoxalin-2-yl]amino]benzaldehyde |
|---|---|
| PubChem CID | 145495864 |
| Molecular Formula | C21H15ClN4OS |
| Molecular Weight | 406.90 g/mol |
| Exact Mass | 406.07 |
| IUPAC Name | 4-[[3-[(4-chlorophenyl)sulfanylamino]quinoxalin-2-yl]amino]benzaldehyde |
| SMILES | O=Cc1ccc(Nc2nc3ccccc3nc2NSc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C21H15ClN4OS/c22-15-7-11-17(12-8-15)28-26-21-20(23-16-9-5-14(13-27)6-10-16)24-18-3-1-2-4-19(18)25-21/h1-13H,(H,23,24)(H,25,26) |
| InChIKey | KHOCRSWASNYACX-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.90 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|