C14H10Cl2N4 — CID 102986618
3-N-(2,6-dichlorophenyl)quinoxaline-2,3-diamine (PubChem CID 102986618) has the molecular formula C14H10Cl2N4 and a molecular weight of 305.17 g/mol. Its IUPAC name is 3-N-(2,6-dichlorophenyl)quinoxaline-2,3-diamine.
| Compound Name | 3-N-(2,6-dichlorophenyl)quinoxaline-2,3-diamine |
|---|---|
| PubChem CID | 102986618 |
| Molecular Formula | C14H10Cl2N4 |
| Molecular Weight | 305.17 g/mol |
| Exact Mass | 304.03 |
| IUPAC Name | 3-N-(2,6-dichlorophenyl)quinoxaline-2,3-diamine |
| SMILES | Nc1nc2ccccc2nc1Nc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C14H10Cl2N4/c15-8-4-3-5-9(16)12(8)20-14-13(17)18-10-6-1-2-7-11(10)19-14/h1-7H,(H2,17,18)(H,19,20) |
| InChIKey | RWKIUOVTGSQBGS-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.17 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |