C14H9F3N4 — CID 102986358
3-N-(2,4,5-trifluorophenyl)quinoxaline-2,3-diamine (PubChem CID 102986358) has the molecular formula C14H9F3N4 and a molecular weight of 290.25 g/mol. Its IUPAC name is 3-N-(2,4,5-trifluorophenyl)quinoxaline-2,3-diamine.
| Compound Name | 3-N-(2,4,5-trifluorophenyl)quinoxaline-2,3-diamine |
|---|---|
| PubChem CID | 102986358 |
| Molecular Formula | C14H9F3N4 |
| Molecular Weight | 290.25 g/mol |
| Exact Mass | 290.08 |
| IUPAC Name | 3-N-(2,4,5-trifluorophenyl)quinoxaline-2,3-diamine |
| SMILES | Nc1nc2ccccc2nc1Nc1cc(F)c(F)cc1F |
| InChI | InChI=1S/C14H9F3N4/c15-7-5-9(17)12(6-8(7)16)21-14-13(18)19-10-3-1-2-4-11(10)20-14/h1-6H,(H2,18,19)(H,20,21) |
| InChIKey | SWXRXDYLYGIHLH-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.25 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|