C15H13FN4 — CID 102983663
3-N-[(3-fluorophenyl)methyl]quinoxaline-2,3-diamine (PubChem CID 102983663) has the molecular formula C15H13FN4 and a molecular weight of 268.30 g/mol. Its IUPAC name is 3-N-[(3-fluorophenyl)methyl]quinoxaline-2,3-diamine.
| Compound Name | 3-N-[(3-fluorophenyl)methyl]quinoxaline-2,3-diamine |
|---|---|
| PubChem CID | 102983663 |
| Molecular Formula | C15H13FN4 |
| Molecular Weight | 268.30 g/mol |
| Exact Mass | 268.11 |
| IUPAC Name | 3-N-[(3-fluorophenyl)methyl]quinoxaline-2,3-diamine |
| SMILES | Nc1nc2ccccc2nc1NCc1cccc(F)c1 |
| InChI | InChI=1S/C15H13FN4/c16-11-5-3-4-10(8-11)9-18-15-14(17)19-12-6-1-2-7-13(12)20-15/h1-8H,9H2,(H2,17,19)(H,18,20) |
| InChIKey | LCTYKAXQICQJLB-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.30 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |