C11H10ClFN4 — CID 14022412
6-chloro-4-N-[(3-fluorophenyl)methyl]pyrimidine-4,5-diamine (PubChem CID 14022412) has the molecular formula C11H10ClFN4 and a molecular weight of 252.68 g/mol. Its IUPAC name is 6-chloro-4-N-[(3-fluorophenyl)methyl]pyrimidine-4,5-diamine.
| Compound Name | 6-chloro-4-N-[(3-fluorophenyl)methyl]pyrimidine-4,5-diamine |
|---|---|
| PubChem CID | 14022412 |
| Molecular Formula | C11H10ClFN4 |
| Molecular Weight | 252.68 g/mol |
| Exact Mass | 252.06 |
| IUPAC Name | 6-chloro-4-N-[(3-fluorophenyl)methyl]pyrimidine-4,5-diamine |
| SMILES | Nc1c(Cl)ncnc1NCc1cccc(F)c1 |
| InChI | InChI=1S/C11H10ClFN4/c12-10-9(14)11(17-6-16-10)15-5-7-2-1-3-8(13)4-7/h1-4,6H,5,14H2,(H,15,16,17) |
| InChIKey | UQTYUISTOINPIB-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.68 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |