C9H9ClN4S — CID 63248168
6-chloro-4-N-(thiophen-3-ylmethyl)pyrimidine-4,5-diamine (PubChem CID 63248168) has the molecular formula C9H9ClN4S and a molecular weight of 240.72 g/mol. Its IUPAC name is 6-chloro-4-N-(thiophen-3-ylmethyl)pyrimidine-4,5-diamine.
| Compound Name | 6-chloro-4-N-(thiophen-3-ylmethyl)pyrimidine-4,5-diamine |
|---|---|
| PubChem CID | 63248168 |
| Molecular Formula | C9H9ClN4S |
| Molecular Weight | 240.72 g/mol |
| Exact Mass | 240.02 |
| IUPAC Name | 6-chloro-4-N-(thiophen-3-ylmethyl)pyrimidine-4,5-diamine |
| SMILES | Nc1c(Cl)ncnc1NCc1ccsc1 |
| InChI | InChI=1S/C9H9ClN4S/c10-8-7(11)9(14-5-13-8)12-3-6-1-2-15-4-6/h1-2,4-5H,3,11H2,(H,12,13,14) |
| InChIKey | UEDWTXLKURHSCX-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.72 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |