C13H13N5S — CID 102986205
3-N-(4,5-dimethyl-1,3-thiazol-2-yl)quinoxaline-2,3-diamine (PubChem CID 102986205) has the molecular formula C13H13N5S and a molecular weight of 271.35 g/mol. Its IUPAC name is 3-N-(4,5-dimethyl-1,3-thiazol-2-yl)quinoxaline-2,3-diamine.
| Compound Name | 3-N-(4,5-dimethyl-1,3-thiazol-2-yl)quinoxaline-2,3-diamine |
|---|---|
| PubChem CID | 102986205 |
| Molecular Formula | C13H13N5S |
| Molecular Weight | 271.35 g/mol |
| Exact Mass | 271.09 |
| IUPAC Name | 3-N-(4,5-dimethyl-1,3-thiazol-2-yl)quinoxaline-2,3-diamine |
| SMILES | Cc1nc(Nc2nc3ccccc3nc2N)sc1C |
| InChI | InChI=1S/C13H13N5S/c1-7-8(2)19-13(15-7)18-12-11(14)16-9-5-3-4-6-10(9)17-12/h3-6H,1-2H3,(H2,14,16)(H,15,17,18) |
| InChIKey | HKDHTBBMOZVSIM-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.35 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |