C16H16ClN7OS — CID 19149615
N'-[5-amino-6-[(4,5-dimethyl-1,3-thiazol-2-yl)amino]pyrimidin-4-yl]-2-chlorobenzohydrazide (PubChem CID 19149615) has the molecular formula C16H16ClN7OS and a molecular weight of 389.87 g/mol. Its IUPAC name is N'-[5-amino-6-[(4,5-dimethyl-1,3-thiazol-2-yl)amino]pyrimidin-4-yl]-2-chlorobenzohydrazide.
| Compound Name | N'-[5-amino-6-[(4,5-dimethyl-1,3-thiazol-2-yl)amino]pyrimidin-4-yl]-2-chlorobenzohydrazide |
|---|---|
| PubChem CID | 19149615 |
| Molecular Formula | C16H16ClN7OS |
| Molecular Weight | 389.87 g/mol |
| Exact Mass | 389.08 |
| IUPAC Name | N'-[5-amino-6-[(4,5-dimethyl-1,3-thiazol-2-yl)amino]pyrimidin-4-yl]-2-chlorobenzohydrazide |
| SMILES | Cc1nc(Nc2ncnc(NNC(=O)c3ccccc3Cl)c2N)sc1C |
| InChI | InChI=1S/C16H16ClN7OS/c1-8-9(2)26-16(21-8)22-13-12(18)14(20-7-19-13)23-24-15(25)10-5-3-4-6-11(10)17/h3-7H,18H2,1-2H3,(H,24,25)(H2,19,20,21,22,23) |
| InChIKey | YWDNIRNLQLUIBO-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 117.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.87 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|