C18H18ClN7O3S — CID 19151296
N'-[5-amino-6-[2-(4-methylphenyl)sulfonylhydrazinyl]pyrimidin-4-yl]-2-chlorobenzohydrazide (PubChem CID 19151296) has the molecular formula C18H18ClN7O3S and a molecular weight of 447.91 g/mol. Its IUPAC name is N'-[5-amino-6-[2-(4-methylphenyl)sulfonylhydrazinyl]pyrimidin-4-yl]-2-chlorobenzohydrazide.
| Compound Name | N'-[5-amino-6-[2-(4-methylphenyl)sulfonylhydrazinyl]pyrimidin-4-yl]-2-chlorobenzohydrazide |
|---|---|
| PubChem CID | 19151296 |
| Molecular Formula | C18H18ClN7O3S |
| Molecular Weight | 447.91 g/mol |
| Exact Mass | 447.09 |
| IUPAC Name | N'-[5-amino-6-[2-(4-methylphenyl)sulfonylhydrazinyl]pyrimidin-4-yl]-2-chlorobenzohydrazide |
| SMILES | Cc1ccc(S(=O)(=O)NNc2ncnc(NNC(=O)c3ccccc3Cl)c2N)cc1 |
| InChI | InChI=1S/C18H18ClN7O3S/c1-11-6-8-12(9-7-11)30(28,29)26-24-17-15(20)16(21-10-22-17)23-25-18(27)13-4-2-3-5-14(13)19/h2-10,26H,20H2,1H3,(H,25,27)(H2,21,22,23,24) |
| InChIKey | UUXSLXQDVLZSCM-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 151.13 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.91 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|