C16H16ClN7O2S — CID 19147120
N'-[5-amino-6-[(5-chloro-2-pyridinyl)amino]pyrimidin-4-yl]-4-methylbenzenesulfonohydrazide (PubChem CID 19147120) has the molecular formula C16H16ClN7O2S and a molecular weight of 405.87 g/mol. Its IUPAC name is N'-[5-amino-6-[(5-chloro-2-pyridinyl)amino]pyrimidin-4-yl]-4-methylbenzenesulfonohydrazide.
| Compound Name | N'-[5-amino-6-[(5-chloro-2-pyridinyl)amino]pyrimidin-4-yl]-4-methylbenzenesulfonohydrazide |
|---|---|
| PubChem CID | 19147120 |
| Molecular Formula | C16H16ClN7O2S |
| Molecular Weight | 405.87 g/mol |
| Exact Mass | 405.08 |
| IUPAC Name | N'-[5-amino-6-[(5-chloro-2-pyridinyl)amino]pyrimidin-4-yl]-4-methylbenzenesulfonohydrazide |
| SMILES | Cc1ccc(S(=O)(=O)NNc2ncnc(Nc3ccc(Cl)cn3)c2N)cc1 |
| InChI | InChI=1S/C16H16ClN7O2S/c1-10-2-5-12(6-3-10)27(25,26)24-23-16-14(18)15(20-9-21-16)22-13-7-4-11(17)8-19-13/h2-9,24H,18H2,1H3,(H2,19,20,21,22,23) |
| InChIKey | DPBZVAQAXWIFOW-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 134.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.87 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|