C17H17IN6O2S — CID 19148920
N'-[5-amino-6-(4-iodoanilino)pyrimidin-4-yl]-4-methylbenzenesulfonohydrazide (PubChem CID 19148920) has the molecular formula C17H17IN6O2S and a molecular weight of 496.33 g/mol. Its IUPAC name is N'-[5-amino-6-(4-iodoanilino)pyrimidin-4-yl]-4-methylbenzenesulfonohydrazide.
| Compound Name | N'-[5-amino-6-(4-iodoanilino)pyrimidin-4-yl]-4-methylbenzenesulfonohydrazide |
|---|---|
| PubChem CID | 19148920 |
| Molecular Formula | C17H17IN6O2S |
| Molecular Weight | 496.33 g/mol |
| Exact Mass | 496.02 |
| IUPAC Name | N'-[5-amino-6-(4-iodoanilino)pyrimidin-4-yl]-4-methylbenzenesulfonohydrazide |
| SMILES | Cc1ccc(S(=O)(=O)NNc2ncnc(Nc3ccc(I)cc3)c2N)cc1 |
| InChI | InChI=1S/C17H17IN6O2S/c1-11-2-8-14(9-3-11)27(25,26)24-23-17-15(19)16(20-10-21-17)22-13-6-4-12(18)5-7-13/h2-10,24H,19H2,1H3,(H2,20,21,22,23) |
| InChIKey | VOQSDQVXLCSRAR-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 122.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.33 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|