C14H15N7O2S2 — CID 19147594
N'-[5-amino-6-(1,3-thiazol-2-ylamino)pyrimidin-4-yl]-4-methylbenzenesulfonohydrazide (PubChem CID 19147594) has the molecular formula C14H15N7O2S2 and a molecular weight of 377.46 g/mol. Its IUPAC name is N'-[5-amino-6-(1,3-thiazol-2-ylamino)pyrimidin-4-yl]-4-methylbenzenesulfonohydrazide.
| Compound Name | N'-[5-amino-6-(1,3-thiazol-2-ylamino)pyrimidin-4-yl]-4-methylbenzenesulfonohydrazide |
|---|---|
| PubChem CID | 19147594 |
| Molecular Formula | C14H15N7O2S2 |
| Molecular Weight | 377.46 g/mol |
| Exact Mass | 377.07 |
| IUPAC Name | N'-[5-amino-6-(1,3-thiazol-2-ylamino)pyrimidin-4-yl]-4-methylbenzenesulfonohydrazide |
| SMILES | Cc1ccc(S(=O)(=O)NNc2ncnc(Nc3nccs3)c2N)cc1 |
| InChI | InChI=1S/C14H15N7O2S2/c1-9-2-4-10(5-3-9)25(22,23)21-20-13-11(15)12(17-8-18-13)19-14-16-6-7-24-14/h2-8,21H,15H2,1H3,(H2,16,17,18,19,20) |
| InChIKey | YVMYRRFBNBUCAE-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 134.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.46 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|