C11H9Cl2IN4 — CID 102762322
3,5-dichloro-6-hydrazinyl-N-(3-iodophenyl)pyridin-2-amine (PubChem CID 102762322) has the molecular formula C11H9Cl2IN4 and a molecular weight of 395.03 g/mol. Its IUPAC name is 3,5-dichloro-6-hydrazinyl-N-(3-iodophenyl)pyridin-2-amine.
| Compound Name | 3,5-dichloro-6-hydrazinyl-N-(3-iodophenyl)pyridin-2-amine |
|---|---|
| PubChem CID | 102762322 |
| Molecular Formula | C11H9Cl2IN4 |
| Molecular Weight | 395.03 g/mol |
| Exact Mass | 393.92 |
| IUPAC Name | 3,5-dichloro-6-hydrazinyl-N-(3-iodophenyl)pyridin-2-amine |
| SMILES | NNc1nc(Nc2cccc(I)c2)c(Cl)cc1Cl |
| InChI | InChI=1S/C11H9Cl2IN4/c12-8-5-9(13)11(18-15)17-10(8)16-7-3-1-2-6(14)4-7/h1-5H,15H2,(H2,16,17,18) |
| InChIKey | MILSICBICRDQJZ-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 62.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.03 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|