C13H11Cl2N5 — CID 107802103
2-[(3,5-dichloro-6-hydrazinyl-2-pyridinyl)amino]-6-methylbenzonitrile (PubChem CID 107802103) has the molecular formula C13H11Cl2N5 and a molecular weight of 308.17 g/mol. Its IUPAC name is 2-[(3,5-dichloro-6-hydrazinyl-2-pyridinyl)amino]-6-methylbenzonitrile.
| Compound Name | 2-[(3,5-dichloro-6-hydrazinyl-2-pyridinyl)amino]-6-methylbenzonitrile |
|---|---|
| PubChem CID | 107802103 |
| Molecular Formula | C13H11Cl2N5 |
| Molecular Weight | 308.17 g/mol |
| Exact Mass | 307.04 |
| IUPAC Name | 2-[(3,5-dichloro-6-hydrazinyl-2-pyridinyl)amino]-6-methylbenzonitrile |
| SMILES | Cc1cccc(Nc2nc(NN)c(Cl)cc2Cl)c1C#N |
| InChI | InChI=1S/C13H11Cl2N5/c1-7-3-2-4-11(8(7)6-16)18-12-9(14)5-10(15)13(19-12)20-17/h2-5H,17H2,1H3,(H2,18,19,20) |
| InChIKey | SRFXWXCESGIZLG-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 86.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.17 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|