C12H8BrCl2N5 — CID 107795514
3-bromo-4-[(3,5-dichloro-6-hydrazinyl-2-pyridinyl)amino]benzonitrile (PubChem CID 107795514) has the molecular formula C12H8BrCl2N5 and a molecular weight of 373.04 g/mol. Its IUPAC name is 3-bromo-4-[(3,5-dichloro-6-hydrazinyl-2-pyridinyl)amino]benzonitrile.
| Compound Name | 3-bromo-4-[(3,5-dichloro-6-hydrazinyl-2-pyridinyl)amino]benzonitrile |
|---|---|
| PubChem CID | 107795514 |
| Molecular Formula | C12H8BrCl2N5 |
| Molecular Weight | 373.04 g/mol |
| Exact Mass | 370.93 |
| IUPAC Name | 3-bromo-4-[(3,5-dichloro-6-hydrazinyl-2-pyridinyl)amino]benzonitrile |
| SMILES | N#Cc1ccc(Nc2nc(NN)c(Cl)cc2Cl)c(Br)c1 |
| InChI | InChI=1S/C12H8BrCl2N5/c13-7-3-6(5-16)1-2-10(7)18-11-8(14)4-9(15)12(19-11)20-17/h1-4H,17H2,(H2,18,19,20) |
| InChIKey | WFTZMVNMLPUVGG-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 86.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.04 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|