C14H15BrN6 — CID 107795538
3-bromo-4-[(6-hydrazinyl-5-propan-2-ylpyrimidin-4-yl)amino]benzonitrile (PubChem CID 107795538) has the molecular formula C14H15BrN6 and a molecular weight of 347.22 g/mol. Its IUPAC name is 3-bromo-4-[(6-hydrazinyl-5-propan-2-ylpyrimidin-4-yl)amino]benzonitrile.
| Compound Name | 3-bromo-4-[(6-hydrazinyl-5-propan-2-ylpyrimidin-4-yl)amino]benzonitrile |
|---|---|
| PubChem CID | 107795538 |
| Molecular Formula | C14H15BrN6 |
| Molecular Weight | 347.22 g/mol |
| Exact Mass | 346.05 |
| IUPAC Name | 3-bromo-4-[(6-hydrazinyl-5-propan-2-ylpyrimidin-4-yl)amino]benzonitrile |
| SMILES | CC(C)c1c(NN)ncnc1Nc1ccc(C#N)cc1Br |
| InChI | InChI=1S/C14H15BrN6/c1-8(2)12-13(18-7-19-14(12)21-17)20-11-4-3-9(6-16)5-10(11)15/h3-5,7-8H,17H2,1-2H3,(H2,18,19,20,21) |
| InChIKey | BLNOVQRKADSQNA-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 99.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.22 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|