C14H14BrN5 — CID 107795355
3-bromo-4-[[6-(ethylamino)-5-methylpyrimidin-4-yl]amino]benzonitrile (PubChem CID 107795355) has the molecular formula C14H14BrN5 and a molecular weight of 332.21 g/mol. Its IUPAC name is 3-bromo-4-[[6-(ethylamino)-5-methylpyrimidin-4-yl]amino]benzonitrile.
| Compound Name | 3-bromo-4-[[6-(ethylamino)-5-methylpyrimidin-4-yl]amino]benzonitrile |
|---|---|
| PubChem CID | 107795355 |
| Molecular Formula | C14H14BrN5 |
| Molecular Weight | 332.21 g/mol |
| Exact Mass | 331.04 |
| IUPAC Name | 3-bromo-4-[[6-(ethylamino)-5-methylpyrimidin-4-yl]amino]benzonitrile |
| SMILES | CCNc1ncnc(Nc2ccc(C#N)cc2Br)c1C |
| InChI | InChI=1S/C14H14BrN5/c1-3-17-13-9(2)14(19-8-18-13)20-12-5-4-10(7-16)6-11(12)15/h4-6,8H,3H2,1-2H3,(H2,17,18,19,20) |
| InChIKey | CZBZPWVYRQYWBJ-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.21 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |