C13H12BrN5 — CID 107795234
3-bromo-4-[[5-methyl-2-(methylamino)pyrimidin-4-yl]amino]benzonitrile (PubChem CID 107795234) has the molecular formula C13H12BrN5 and a molecular weight of 318.18 g/mol. Its IUPAC name is 3-bromo-4-[[5-methyl-2-(methylamino)pyrimidin-4-yl]amino]benzonitrile.
| Compound Name | 3-bromo-4-[[5-methyl-2-(methylamino)pyrimidin-4-yl]amino]benzonitrile |
|---|---|
| PubChem CID | 107795234 |
| Molecular Formula | C13H12BrN5 |
| Molecular Weight | 318.18 g/mol |
| Exact Mass | 317.03 |
| IUPAC Name | 3-bromo-4-[[5-methyl-2-(methylamino)pyrimidin-4-yl]amino]benzonitrile |
| SMILES | CNc1ncc(C)c(Nc2ccc(C#N)cc2Br)n1 |
| InChI | InChI=1S/C13H12BrN5/c1-8-7-17-13(16-2)19-12(8)18-11-4-3-9(6-15)5-10(11)14/h3-5,7H,1-2H3,(H2,16,17,18,19) |
| InChIKey | BWCLNJXTQSRDFN-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.18 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |