C12H9ClFN5 — CID 107810601
3-chloro-4-[[5-fluoro-2-(methylamino)pyrimidin-4-yl]amino]benzonitrile (PubChem CID 107810601) has the molecular formula C12H9ClFN5 and a molecular weight of 277.69 g/mol. Its IUPAC name is 3-chloro-4-[[5-fluoro-2-(methylamino)pyrimidin-4-yl]amino]benzonitrile.
| Compound Name | 3-chloro-4-[[5-fluoro-2-(methylamino)pyrimidin-4-yl]amino]benzonitrile |
|---|---|
| PubChem CID | 107810601 |
| Molecular Formula | C12H9ClFN5 |
| Molecular Weight | 277.69 g/mol |
| Exact Mass | 277.05 |
| IUPAC Name | 3-chloro-4-[[5-fluoro-2-(methylamino)pyrimidin-4-yl]amino]benzonitrile |
| SMILES | CNc1ncc(F)c(Nc2ccc(C#N)cc2Cl)n1 |
| InChI | InChI=1S/C12H9ClFN5/c1-16-12-17-6-9(14)11(19-12)18-10-3-2-7(5-15)4-8(10)13/h2-4,6H,1H3,(H2,16,17,18,19) |
| InChIKey | BAQLFOCQNNFCJL-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.69 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |