C12H11BrN6S — CID 107795536
3-bromo-4-[(6-hydrazinyl-2-methylsulfanylpyrimidin-4-yl)amino]benzonitrile (PubChem CID 107795536) has the molecular formula C12H11BrN6S and a molecular weight of 351.23 g/mol. Its IUPAC name is 3-bromo-4-[(6-hydrazinyl-2-methylsulfanylpyrimidin-4-yl)amino]benzonitrile.
| Compound Name | 3-bromo-4-[(6-hydrazinyl-2-methylsulfanylpyrimidin-4-yl)amino]benzonitrile |
|---|---|
| PubChem CID | 107795536 |
| Molecular Formula | C12H11BrN6S |
| Molecular Weight | 351.23 g/mol |
| Exact Mass | 349.99 |
| IUPAC Name | 3-bromo-4-[(6-hydrazinyl-2-methylsulfanylpyrimidin-4-yl)amino]benzonitrile |
| SMILES | CSc1nc(NN)cc(Nc2ccc(C#N)cc2Br)n1 |
| InChI | InChI=1S/C12H11BrN6S/c1-20-12-17-10(5-11(18-12)19-15)16-9-3-2-7(6-14)4-8(9)13/h2-5H,15H2,1H3,(H2,16,17,18,19) |
| InChIKey | QJHRPZIWNNDUSZ-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 99.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.23 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|