C11H11ClFN5S — CID 80906036
N-(5-chloro-2-fluorophenyl)-6-hydrazinyl-2-methylsulfanylpyrimidin-4-amine (PubChem CID 80906036) has the molecular formula C11H11ClFN5S and a molecular weight of 299.76 g/mol. Its IUPAC name is N-(5-chloro-2-fluorophenyl)-6-hydrazinyl-2-methylsulfanylpyrimidin-4-amine.
| Compound Name | N-(5-chloro-2-fluorophenyl)-6-hydrazinyl-2-methylsulfanylpyrimidin-4-amine |
|---|---|
| PubChem CID | 80906036 |
| Molecular Formula | C11H11ClFN5S |
| Molecular Weight | 299.76 g/mol |
| Exact Mass | 299.04 |
| IUPAC Name | N-(5-chloro-2-fluorophenyl)-6-hydrazinyl-2-methylsulfanylpyrimidin-4-amine |
| SMILES | CSc1nc(NN)cc(Nc2cc(Cl)ccc2F)n1 |
| InChI | InChI=1S/C11H11ClFN5S/c1-19-11-16-9(5-10(17-11)18-14)15-8-4-6(12)2-3-7(8)13/h2-5H,14H2,1H3,(H2,15,16,17,18) |
| InChIKey | BNXDJIZWHHERBJ-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.76 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|