C14H14N6S — CID 80912895
N-(6-hydrazinyl-2-methylsulfanylpyrimidin-4-yl)quinolin-8-amine (PubChem CID 80912895) has the molecular formula C14H14N6S and a molecular weight of 298.38 g/mol. Its IUPAC name is N-(6-hydrazinyl-2-methylsulfanylpyrimidin-4-yl)quinolin-8-amine.
| Compound Name | N-(6-hydrazinyl-2-methylsulfanylpyrimidin-4-yl)quinolin-8-amine |
|---|---|
| PubChem CID | 80912895 |
| Molecular Formula | C14H14N6S |
| Molecular Weight | 298.38 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | N-(6-hydrazinyl-2-methylsulfanylpyrimidin-4-yl)quinolin-8-amine |
| SMILES | CSc1nc(NN)cc(Nc2cccc3cccnc23)n1 |
| InChI | InChI=1S/C14H14N6S/c1-21-14-18-11(8-12(19-14)20-15)17-10-6-2-4-9-5-3-7-16-13(9)10/h2-8H,15H2,1H3,(H2,17,18,19,20) |
| InChIKey | UYSICHHLPYVNKT-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 88.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.38 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|