C15H16BrN5 — CID 107795247
3-bromo-4-[[6-(methylamino)-2-propan-2-ylpyrimidin-4-yl]amino]benzonitrile (PubChem CID 107795247) has the molecular formula C15H16BrN5 and a molecular weight of 346.23 g/mol. Its IUPAC name is 3-bromo-4-[[6-(methylamino)-2-propan-2-ylpyrimidin-4-yl]amino]benzonitrile.
| Compound Name | 3-bromo-4-[[6-(methylamino)-2-propan-2-ylpyrimidin-4-yl]amino]benzonitrile |
|---|---|
| PubChem CID | 107795247 |
| Molecular Formula | C15H16BrN5 |
| Molecular Weight | 346.23 g/mol |
| Exact Mass | 345.06 |
| IUPAC Name | 3-bromo-4-[[6-(methylamino)-2-propan-2-ylpyrimidin-4-yl]amino]benzonitrile |
| SMILES | CNc1cc(Nc2ccc(C#N)cc2Br)nc(C(C)C)n1 |
| InChI | InChI=1S/C15H16BrN5/c1-9(2)15-20-13(18-3)7-14(21-15)19-12-5-4-10(8-17)6-11(12)16/h4-7,9H,1-3H3,(H2,18,19,20,21) |
| InChIKey | WZHJATSPIUXJCF-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.23 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |