C12H11Cl3N4 — CID 102762246
3,5-dichloro-N-(2-chloro-6-methylphenyl)-6-hydrazinylpyridin-2-amine (PubChem CID 102762246) has the molecular formula C12H11Cl3N4 and a molecular weight of 317.61 g/mol. Its IUPAC name is 3,5-dichloro-N-(2-chloro-6-methylphenyl)-6-hydrazinylpyridin-2-amine.
| Compound Name | 3,5-dichloro-N-(2-chloro-6-methylphenyl)-6-hydrazinylpyridin-2-amine |
|---|---|
| PubChem CID | 102762246 |
| Molecular Formula | C12H11Cl3N4 |
| Molecular Weight | 317.61 g/mol |
| Exact Mass | 316.00 |
| IUPAC Name | 3,5-dichloro-N-(2-chloro-6-methylphenyl)-6-hydrazinylpyridin-2-amine |
| SMILES | Cc1cccc(Cl)c1Nc1nc(NN)c(Cl)cc1Cl |
| InChI | InChI=1S/C12H11Cl3N4/c1-6-3-2-4-7(13)10(6)17-11-8(14)5-9(15)12(18-11)19-16/h2-5H,16H2,1H3,(H2,17,18,19) |
| InChIKey | KYDYSXFNFARDMT-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 62.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.61 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|