C11H11BrFN5O — CID 114262908
5-bromo-N-(3-fluoro-5-methoxyphenyl)-6-hydrazinylpyrimidin-4-amine (PubChem CID 114262908) has the molecular formula C11H11BrFN5O and a molecular weight of 328.15 g/mol. Its IUPAC name is 5-bromo-N-(3-fluoro-5-methoxyphenyl)-6-hydrazinylpyrimidin-4-amine.
| Compound Name | 5-bromo-N-(3-fluoro-5-methoxyphenyl)-6-hydrazinylpyrimidin-4-amine |
|---|---|
| PubChem CID | 114262908 |
| Molecular Formula | C11H11BrFN5O |
| Molecular Weight | 328.15 g/mol |
| Exact Mass | 327.01 |
| IUPAC Name | 5-bromo-N-(3-fluoro-5-methoxyphenyl)-6-hydrazinylpyrimidin-4-amine |
| SMILES | COc1cc(F)cc(Nc2ncnc(NN)c2Br)c1 |
| InChI | InChI=1S/C11H11BrFN5O/c1-19-8-3-6(13)2-7(4-8)17-10-9(12)11(18-14)16-5-15-10/h2-5H,14H2,1H3,(H2,15,16,17,18) |
| InChIKey | MVJNWSNLKRRDBW-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 85.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.15 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|