C20H20FN5O3 — CID 155554018
1-(3,5-dimethoxyphenyl)-3-[6-(3-fluoro-5-methylanilino)pyrimidin-4-yl]urea (PubChem CID 155554018) has the molecular formula C20H20FN5O3 and a molecular weight of 397.41 g/mol. Its IUPAC name is 1-(3,5-dimethoxyphenyl)-3-[6-(3-fluoro-5-methylanilino)pyrimidin-4-yl]urea.
| Compound Name | 1-(3,5-dimethoxyphenyl)-3-[6-(3-fluoro-5-methylanilino)pyrimidin-4-yl]urea |
|---|---|
| PubChem CID | 155554018 |
| Molecular Formula | C20H20FN5O3 |
| Molecular Weight | 397.41 g/mol |
| Exact Mass | 397.16 |
| IUPAC Name | 1-(3,5-dimethoxyphenyl)-3-[6-(3-fluoro-5-methylanilino)pyrimidin-4-yl]urea |
| SMILES | COc1cc(NC(=O)Nc2cc(Nc3cc(C)cc(F)c3)ncn2)cc(OC)c1 |
| InChI | InChI=1S/C20H20FN5O3/c1-12-4-13(21)6-14(5-12)24-18-10-19(23-11-22-18)26-20(27)25-15-7-16(28-2)9-17(8-15)29-3/h4-11H,1-3H3,(H3,22,23,24,25,26,27) |
| InChIKey | WLRLBZXKQVGMLY-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 97.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.41 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |