C18H16N4O3 — CID 113193145
3-[[6-(3-methoxyanilino)pyrimidin-4-yl]amino]benzoic acid (PubChem CID 113193145) has the molecular formula C18H16N4O3 and a molecular weight of 336.35 g/mol. Its IUPAC name is 3-[[6-(3-methoxyanilino)pyrimidin-4-yl]amino]benzoic acid.
| Compound Name | 3-[[6-(3-methoxyanilino)pyrimidin-4-yl]amino]benzoic acid |
|---|---|
| PubChem CID | 113193145 |
| Molecular Formula | C18H16N4O3 |
| Molecular Weight | 336.35 g/mol |
| Exact Mass | 336.12 |
| IUPAC Name | 3-[[6-(3-methoxyanilino)pyrimidin-4-yl]amino]benzoic acid |
| SMILES | COc1cccc(Nc2cc(Nc3cccc(C(=O)O)c3)ncn2)c1 |
| InChI | InChI=1S/C18H16N4O3/c1-25-15-7-3-6-14(9-15)22-17-10-16(19-11-20-17)21-13-5-2-4-12(8-13)18(23)24/h2-11H,1H3,(H,23,24)(H2,19,20,21,22) |
| InChIKey | RZCRMLGCAVJOQH-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 96.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.35 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |