C18H15ClN4O3 — CID 113193141
3-[[6-(5-chloro-2-methoxyanilino)pyrimidin-4-yl]amino]benzoic acid (PubChem CID 113193141) has the molecular formula C18H15ClN4O3 and a molecular weight of 370.80 g/mol. Its IUPAC name is 3-[[6-(5-chloro-2-methoxyanilino)pyrimidin-4-yl]amino]benzoic acid.
| Compound Name | 3-[[6-(5-chloro-2-methoxyanilino)pyrimidin-4-yl]amino]benzoic acid |
|---|---|
| PubChem CID | 113193141 |
| Molecular Formula | C18H15ClN4O3 |
| Molecular Weight | 370.80 g/mol |
| Exact Mass | 370.08 |
| IUPAC Name | 3-[[6-(5-chloro-2-methoxyanilino)pyrimidin-4-yl]amino]benzoic acid |
| SMILES | COc1ccc(Cl)cc1Nc1cc(Nc2cccc(C(=O)O)c2)ncn1 |
| InChI | InChI=1S/C18H15ClN4O3/c1-26-15-6-5-12(19)8-14(15)23-17-9-16(20-10-21-17)22-13-4-2-3-11(7-13)18(24)25/h2-10H,1H3,(H,24,25)(H2,20,21,22,23) |
| InChIKey | AZSLYIPYBHHQDK-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 96.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.80 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |