C23H18N4O3 — CID 113193183
3-[[6-(2-phenoxyanilino)pyrimidin-4-yl]amino]benzoic acid (PubChem CID 113193183) has the molecular formula C23H18N4O3 and a molecular weight of 398.42 g/mol. Its IUPAC name is 3-[[6-(2-phenoxyanilino)pyrimidin-4-yl]amino]benzoic acid.
| Compound Name | 3-[[6-(2-phenoxyanilino)pyrimidin-4-yl]amino]benzoic acid |
|---|---|
| PubChem CID | 113193183 |
| Molecular Formula | C23H18N4O3 |
| Molecular Weight | 398.42 g/mol |
| Exact Mass | 398.14 |
| IUPAC Name | 3-[[6-(2-phenoxyanilino)pyrimidin-4-yl]amino]benzoic acid |
| SMILES | O=C(O)c1cccc(Nc2cc(Nc3ccccc3Oc3ccccc3)ncn2)c1 |
| InChI | InChI=1S/C23H18N4O3/c28-23(29)16-7-6-8-17(13-16)26-21-14-22(25-15-24-21)27-19-11-4-5-12-20(19)30-18-9-2-1-3-10-18/h1-15H,(H,28,29)(H2,24,25,26,27) |
| InChIKey | PHIDGXSWEWVFEM-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 96.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.42 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |