C21H24N6O4S — CID 87653705
1-cyclobutyl-1-sulfanyl-3-[3-(3,4,5-trimethoxyanilino)pyrido[2,3-b]pyrazin-6-yl]urea (PubChem CID 87653705) has the molecular formula C21H24N6O4S and a molecular weight of 456.53 g/mol. Its IUPAC name is 1-cyclobutyl-1-sulfanyl-3-[3-(3,4,5-trimethoxyanilino)pyrido[2,3-b]pyrazin-6-yl]urea.
| Compound Name | 1-cyclobutyl-1-sulfanyl-3-[3-(3,4,5-trimethoxyanilino)pyrido[2,3-b]pyrazin-6-yl]urea |
|---|---|
| PubChem CID | 87653705 |
| Molecular Formula | C21H24N6O4S |
| Molecular Weight | 456.53 g/mol |
| Exact Mass | 456.16 |
| IUPAC Name | 1-cyclobutyl-1-sulfanyl-3-[3-(3,4,5-trimethoxyanilino)pyrido[2,3-b]pyrazin-6-yl]urea |
| SMILES | COc1cc(Nc2cnc3ccc(NC(=O)N(S)C4CCC4)nc3n2)cc(OC)c1OC |
| InChI | InChI=1S/C21H24N6O4S/c1-29-15-9-12(10-16(30-2)19(15)31-3)23-18-11-22-14-7-8-17(24-20(14)25-18)26-21(28)27(32)13-5-4-6-13/h7-11,13,32H,4-6H2,1-3H3,(H2,23,24,25,26,28) |
| InChIKey | PFWFDFKVRUTJKC-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 110.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.53 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|