C25H35N3O3S — CID 100571710
1-(4-propan-2-ylphenyl)-3-[1-[(3,4,5-trimethoxyphenyl)methyl]piperidin-4-yl]thiourea (PubChem CID 100571710) has the molecular formula C25H35N3O3S and a molecular weight of 457.64 g/mol. Its IUPAC name is 1-(4-propan-2-ylphenyl)-3-[1-[(3,4,5-trimethoxyphenyl)methyl]piperidin-4-yl]thiourea.
| Compound Name | 1-(4-propan-2-ylphenyl)-3-[1-[(3,4,5-trimethoxyphenyl)methyl]piperidin-4-yl]thiourea |
|---|---|
| PubChem CID | 100571710 |
| Molecular Formula | C25H35N3O3S |
| Molecular Weight | 457.64 g/mol |
| Exact Mass | 457.24 |
| IUPAC Name | 1-(4-propan-2-ylphenyl)-3-[1-[(3,4,5-trimethoxyphenyl)methyl]piperidin-4-yl]thiourea |
| SMILES | COc1cc(CN2CCC(NC(=S)Nc3ccc(C(C)C)cc3)CC2)cc(OC)c1OC |
| InChI | InChI=1S/C25H35N3O3S/c1-17(2)19-6-8-20(9-7-19)26-25(32)27-21-10-12-28(13-11-21)16-18-14-22(29-3)24(31-5)23(15-18)30-4/h6-9,14-15,17,21H,10-13,16H2,1-5H3,(H2,26,27,32) |
| InChIKey | STVMWMVQZQDRKX-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 54.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.64 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|