C26H33N3O7S — CID 100571739
dimethyl 5-[[1-[(3,4,5-trimethoxyphenyl)methyl]piperidin-4-yl]carbamothioylamino]benzene-1,3-dicarboxylate (PubChem CID 100571739) has the molecular formula C26H33N3O7S and a molecular weight of 531.63 g/mol. Its IUPAC name is dimethyl 5-[[1-[(3,4,5-trimethoxyphenyl)methyl]piperidin-4-yl]carbamothioylamino]benzene-1,3-dicarboxylate.
| Compound Name | dimethyl 5-[[1-[(3,4,5-trimethoxyphenyl)methyl]piperidin-4-yl]carbamothioylamino]benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 100571739 |
| Molecular Formula | C26H33N3O7S |
| Molecular Weight | 531.63 g/mol |
| Exact Mass | 531.20 |
| IUPAC Name | dimethyl 5-[[1-[(3,4,5-trimethoxyphenyl)methyl]piperidin-4-yl]carbamothioylamino]benzene-1,3-dicarboxylate |
| SMILES | COC(=O)c1cc(NC(=S)NC2CCN(Cc3cc(OC)c(OC)c(OC)c3)CC2)cc(C(=O)OC)c1 |
| InChI | InChI=1S/C26H33N3O7S/c1-32-21-10-16(11-22(33-2)23(21)34-3)15-29-8-6-19(7-9-29)27-26(37)28-20-13-17(24(30)35-4)12-18(14-20)25(31)36-5/h10-14,19H,6-9,15H2,1-5H3,(H2,27,28,37) |
| InChIKey | RORUCHWAMBETBV-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 107.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.63 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|