C24H33N3O3S — CID 100571463
1-(3,5-dimethylphenyl)-3-[1-[(3,4,5-trimethoxyphenyl)methyl]piperidin-4-yl]thiourea (PubChem CID 100571463) has the molecular formula C24H33N3O3S and a molecular weight of 443.61 g/mol. Its IUPAC name is 1-(3,5-dimethylphenyl)-3-[1-[(3,4,5-trimethoxyphenyl)methyl]piperidin-4-yl]thiourea.
| Compound Name | 1-(3,5-dimethylphenyl)-3-[1-[(3,4,5-trimethoxyphenyl)methyl]piperidin-4-yl]thiourea |
|---|---|
| PubChem CID | 100571463 |
| Molecular Formula | C24H33N3O3S |
| Molecular Weight | 443.61 g/mol |
| Exact Mass | 443.22 |
| IUPAC Name | 1-(3,5-dimethylphenyl)-3-[1-[(3,4,5-trimethoxyphenyl)methyl]piperidin-4-yl]thiourea |
| SMILES | COc1cc(CN2CCC(NC(=S)Nc3cc(C)cc(C)c3)CC2)cc(OC)c1OC |
| InChI | InChI=1S/C24H33N3O3S/c1-16-10-17(2)12-20(11-16)26-24(31)25-19-6-8-27(9-7-19)15-18-13-21(28-3)23(30-5)22(14-18)29-4/h10-14,19H,6-9,15H2,1-5H3,(H2,25,26,31) |
| InChIKey | MPCHZMUKXBHJAX-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 54.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.61 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|