C25H32N4O8 — CID 12821281
4-acetamido-2-methoxy-5-nitro-N-[1-[(3,4,5-trimethoxyphenyl)methyl]piperidin-4-yl]benzamide (PubChem CID 12821281) has the molecular formula C25H32N4O8 and a molecular weight of 516.55 g/mol. Its IUPAC name is 4-acetamido-2-methoxy-5-nitro-N-[1-[(3,4,5-trimethoxyphenyl)methyl]piperidin-4-yl]benzamide.
| Compound Name | 4-acetamido-2-methoxy-5-nitro-N-[1-[(3,4,5-trimethoxyphenyl)methyl]piperidin-4-yl]benzamide |
|---|---|
| PubChem CID | 12821281 |
| Molecular Formula | C25H32N4O8 |
| Molecular Weight | 516.55 g/mol |
| Exact Mass | 516.22 |
| IUPAC Name | 4-acetamido-2-methoxy-5-nitro-N-[1-[(3,4,5-trimethoxyphenyl)methyl]piperidin-4-yl]benzamide |
| SMILES | COc1cc(NC(C)=O)c([N+](=O)[O-])cc1C(=O)NC1CCN(Cc2cc(OC)c(OC)c(OC)c2)CC1 |
| InChI | InChI=1S/C25H32N4O8/c1-15(30)26-19-13-21(34-2)18(12-20(19)29(32)33)25(31)27-17-6-8-28(9-7-17)14-16-10-22(35-3)24(37-5)23(11-16)36-4/h10-13,17H,6-9,14H2,1-5H3,(H,26,30)(H,27,31) |
| InChIKey | BAICIQMKUITUFF-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 141.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.55 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|