C20H27ClN4O4 — CID 12796096
4-amino-N-[1-(cyclohexa-1,4-dien-1-ylmethyl)piperidin-4-yl]-2-methoxy-5-nitrobenzamide;hydrochloride (PubChem CID 12796096) has the molecular formula C20H27ClN4O4 and a molecular weight of 422.91 g/mol. Its IUPAC name is 4-amino-N-[1-(cyclohexa-1,4-dien-1-ylmethyl)piperidin-4-yl]-2-methoxy-5-nitrobenzamide;hydrochloride.
| Compound Name | 4-amino-N-[1-(cyclohexa-1,4-dien-1-ylmethyl)piperidin-4-yl]-2-methoxy-5-nitrobenzamide;hydrochloride |
|---|---|
| PubChem CID | 12796096 |
| Molecular Formula | C20H27ClN4O4 |
| Molecular Weight | 422.91 g/mol |
| Exact Mass | 422.17 |
| IUPAC Name | 4-amino-N-[1-(cyclohexa-1,4-dien-1-ylmethyl)piperidin-4-yl]-2-methoxy-5-nitrobenzamide;hydrochloride |
| SMILES | COc1cc(N)c([N+](=O)[O-])cc1C(=O)NC1CCN(CC2=CCC=CC2)CC1.Cl |
| InChI | InChI=1S/C20H26N4O4.ClH/c1-28-19-12-17(21)18(24(26)27)11-16(19)20(25)22-15-7-9-23(10-8-15)13-14-5-3-2-4-6-14;/h2-3,6,11-12,15H,4-5,7-10,13,21H2,1H3,(H,22,25);1H |
| InChIKey | BRZIRVXQYNNUKS-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 110.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.91 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|