C20H29Cl2N3O3 — CID 70607387
4-amino-5-chloro-N-[1-(cyclohexa-1,4-dien-1-ylmethyl)piperidin-4-yl]-2-methoxybenzamide;hydrate;hydrochloride (PubChem CID 70607387) has the molecular formula C20H29Cl2N3O3 and a molecular weight of 430.38 g/mol. Its IUPAC name is 4-amino-5-chloro-N-[1-(cyclohexa-1,4-dien-1-ylmethyl)piperidin-4-yl]-2-methoxybenzamide;hydrate;hydrochloride.
| Compound Name | 4-amino-5-chloro-N-[1-(cyclohexa-1,4-dien-1-ylmethyl)piperidin-4-yl]-2-methoxybenzamide;hydrate;hydrochloride |
|---|---|
| PubChem CID | 70607387 |
| Molecular Formula | C20H29Cl2N3O3 |
| Molecular Weight | 430.38 g/mol |
| Exact Mass | 429.16 |
| IUPAC Name | 4-amino-5-chloro-N-[1-(cyclohexa-1,4-dien-1-ylmethyl)piperidin-4-yl]-2-methoxybenzamide;hydrate;hydrochloride |
| SMILES | COc1cc(N)c(Cl)cc1C(=O)NC1CCN(CC2=CCC=CC2)CC1.Cl.O |
| InChI | InChI=1S/C20H26ClN3O2.ClH.H2O/c1-26-19-12-18(22)17(21)11-16(19)20(25)23-15-7-9-24(10-8-15)13-14-5-3-2-4-6-14;;/h2-3,6,11-12,15H,4-5,7-10,13,22H2,1H3,(H,23,25);1H;1H2 |
| InChIKey | MOYYNKYKIIPYEW-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 99.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.38 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|