C22H34ClN5O2S — CID 10205298
4-amino-5-chloro-N-[1-[[1-(dimethylcarbamothioyl)piperidin-4-yl]methyl]piperidin-4-yl]-2-methoxybenzamide (PubChem CID 10205298) has the molecular formula C22H34ClN5O2S and a molecular weight of 468.07 g/mol. Its IUPAC name is 4-amino-5-chloro-N-[1-[[1-(dimethylcarbamothioyl)piperidin-4-yl]methyl]piperidin-4-yl]-2-methoxybenzamide.
| Compound Name | 4-amino-5-chloro-N-[1-[[1-(dimethylcarbamothioyl)piperidin-4-yl]methyl]piperidin-4-yl]-2-methoxybenzamide |
|---|---|
| PubChem CID | 10205298 |
| Molecular Formula | C22H34ClN5O2S |
| Molecular Weight | 468.07 g/mol |
| Exact Mass | 467.21 |
| IUPAC Name | 4-amino-5-chloro-N-[1-[[1-(dimethylcarbamothioyl)piperidin-4-yl]methyl]piperidin-4-yl]-2-methoxybenzamide |
| SMILES | COc1cc(N)c(Cl)cc1C(=O)NC1CCN(CC2CCN(C(=S)N(C)C)CC2)CC1 |
| InChI | InChI=1S/C22H34ClN5O2S/c1-26(2)22(31)28-10-4-15(5-11-28)14-27-8-6-16(7-9-27)25-21(29)17-12-18(23)19(24)13-20(17)30-3/h12-13,15-16H,4-11,14,24H2,1-3H3,(H,25,29) |
| InChIKey | KNDBMEOYRFLLMZ-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 74.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.07 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|