C24H35ClN4O4 — CID 23434014
4-amino-5-chloro-2-methoxy-N-[1-[[1-(oxolane-2-carbonyl)piperidin-4-yl]methyl]piperidin-4-yl]benzamide (PubChem CID 23434014) has the molecular formula C24H35ClN4O4 and a molecular weight of 479.02 g/mol. Its IUPAC name is 4-amino-5-chloro-2-methoxy-N-[1-[[1-(oxolane-2-carbonyl)piperidin-4-yl]methyl]piperidin-4-yl]benzamide.
| Compound Name | 4-amino-5-chloro-2-methoxy-N-[1-[[1-(oxolane-2-carbonyl)piperidin-4-yl]methyl]piperidin-4-yl]benzamide |
|---|---|
| PubChem CID | 23434014 |
| Molecular Formula | C24H35ClN4O4 |
| Molecular Weight | 479.02 g/mol |
| Exact Mass | 478.23 |
| IUPAC Name | 4-amino-5-chloro-2-methoxy-N-[1-[[1-(oxolane-2-carbonyl)piperidin-4-yl]methyl]piperidin-4-yl]benzamide |
| SMILES | COc1cc(N)c(Cl)cc1C(=O)NC1CCN(CC2CCN(C(=O)C3CCCO3)CC2)CC1 |
| InChI | InChI=1S/C24H35ClN4O4/c1-32-22-14-20(26)19(25)13-18(22)23(30)27-17-6-8-28(9-7-17)15-16-4-10-29(11-5-16)24(31)21-3-2-12-33-21/h13-14,16-17,21H,2-12,15,26H2,1H3,(H,27,30) |
| InChIKey | MMAHZLJRNLZQCI-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 97.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.02 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|