C24H40ClN5O2 — CID 139786696
4-amino-5-chloro-N-[1-[[1-[3-(ethylamino)propyl]piperidin-4-yl]methyl]piperidin-4-yl]-2-methoxybenzamide (PubChem CID 139786696) has the molecular formula C24H40ClN5O2 and a molecular weight of 466.07 g/mol. Its IUPAC name is 4-amino-5-chloro-N-[1-[[1-[3-(ethylamino)propyl]piperidin-4-yl]methyl]piperidin-4-yl]-2-methoxybenzamide.
| Compound Name | 4-amino-5-chloro-N-[1-[[1-[3-(ethylamino)propyl]piperidin-4-yl]methyl]piperidin-4-yl]-2-methoxybenzamide |
|---|---|
| PubChem CID | 139786696 |
| Molecular Formula | C24H40ClN5O2 |
| Molecular Weight | 466.07 g/mol |
| Exact Mass | 465.29 |
| IUPAC Name | 4-amino-5-chloro-N-[1-[[1-[3-(ethylamino)propyl]piperidin-4-yl]methyl]piperidin-4-yl]-2-methoxybenzamide |
| SMILES | CCNCCCN1CCC(CN2CCC(NC(=O)c3cc(Cl)c(N)cc3OC)CC2)CC1 |
| InChI | InChI=1S/C24H40ClN5O2/c1-3-27-9-4-10-29-11-5-18(6-12-29)17-30-13-7-19(8-14-30)28-24(31)20-15-21(25)22(26)16-23(20)32-2/h15-16,18-19,27H,3-14,17,26H2,1-2H3,(H,28,31) |
| InChIKey | NMMDPNCUPBZLAN-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 82.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.07 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|