C25H34ClN3O4S — CID 54165330
4-amino-N-[[1-(4-benzylsulfonylbutyl)piperidin-4-yl]methyl]-5-chloro-2-methoxybenzamide (PubChem CID 54165330) has the molecular formula C25H34ClN3O4S and a molecular weight of 508.08 g/mol. Its IUPAC name is 4-amino-N-[[1-(4-benzylsulfonylbutyl)piperidin-4-yl]methyl]-5-chloro-2-methoxybenzamide.
| Compound Name | 4-amino-N-[[1-(4-benzylsulfonylbutyl)piperidin-4-yl]methyl]-5-chloro-2-methoxybenzamide |
|---|---|
| PubChem CID | 54165330 |
| Molecular Formula | C25H34ClN3O4S |
| Molecular Weight | 508.08 g/mol |
| Exact Mass | 507.20 |
| IUPAC Name | 4-amino-N-[[1-(4-benzylsulfonylbutyl)piperidin-4-yl]methyl]-5-chloro-2-methoxybenzamide |
| SMILES | COc1cc(N)c(Cl)cc1C(=O)NCC1CCN(CCCCS(=O)(=O)Cc2ccccc2)CC1 |
| InChI | InChI=1S/C25H34ClN3O4S/c1-33-24-16-23(27)22(26)15-21(24)25(30)28-17-19-9-12-29(13-10-19)11-5-6-14-34(31,32)18-20-7-3-2-4-8-20/h2-4,7-8,15-16,19H,5-6,9-14,17-18,27H2,1H3,(H,28,30) |
| InChIKey | ORGJHPHRFGIHNO-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.08 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|