C23H30ClN3O2S — CID 54506693
4-amino-5-chloro-2-methoxy-N-[[1-(3-phenylsulfanylpropyl)piperidin-4-yl]methyl]benzamide (PubChem CID 54506693) has the molecular formula C23H30ClN3O2S and a molecular weight of 448.03 g/mol. Its IUPAC name is 4-amino-5-chloro-2-methoxy-N-[[1-(3-phenylsulfanylpropyl)piperidin-4-yl]methyl]benzamide.
| Compound Name | 4-amino-5-chloro-2-methoxy-N-[[1-(3-phenylsulfanylpropyl)piperidin-4-yl]methyl]benzamide |
|---|---|
| PubChem CID | 54506693 |
| Molecular Formula | C23H30ClN3O2S |
| Molecular Weight | 448.03 g/mol |
| Exact Mass | 447.17 |
| IUPAC Name | 4-amino-5-chloro-2-methoxy-N-[[1-(3-phenylsulfanylpropyl)piperidin-4-yl]methyl]benzamide |
| SMILES | COc1cc(N)c(Cl)cc1C(=O)NCC1CCN(CCCSc2ccccc2)CC1 |
| InChI | InChI=1S/C23H30ClN3O2S/c1-29-22-15-21(25)20(24)14-19(22)23(28)26-16-17-8-11-27(12-9-17)10-5-13-30-18-6-3-2-4-7-18/h2-4,6-7,14-15,17H,5,8-13,16,25H2,1H3,(H,26,28) |
| InChIKey | YGFFTDVGWAJOTK-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.03 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|