C20H31ClN4O3 — CID 15840963
N-[[1-(5-acetamidopentyl)pyrrolidin-3-yl]methyl]-4-amino-5-chloro-2-methoxybenzamide (PubChem CID 15840963) has the molecular formula C20H31ClN4O3 and a molecular weight of 410.95 g/mol. Its IUPAC name is N-[[1-(5-acetamidopentyl)pyrrolidin-3-yl]methyl]-4-amino-5-chloro-2-methoxybenzamide.
| Compound Name | N-[[1-(5-acetamidopentyl)pyrrolidin-3-yl]methyl]-4-amino-5-chloro-2-methoxybenzamide |
|---|---|
| PubChem CID | 15840963 |
| Molecular Formula | C20H31ClN4O3 |
| Molecular Weight | 410.95 g/mol |
| Exact Mass | 410.21 |
| IUPAC Name | N-[[1-(5-acetamidopentyl)pyrrolidin-3-yl]methyl]-4-amino-5-chloro-2-methoxybenzamide |
| SMILES | COc1cc(N)c(Cl)cc1C(=O)NCC1CCN(CCCCCNC(C)=O)C1 |
| InChI | InChI=1S/C20H31ClN4O3/c1-14(26)23-7-4-3-5-8-25-9-6-15(13-25)12-24-20(27)16-10-17(21)18(22)11-19(16)28-2/h10-11,15H,3-9,12-13,22H2,1-2H3,(H,23,26)(H,24,27) |
| InChIKey | RQZAIRNFYMAVIV-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.95 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|