C19H30ClN5O2S — CID 54547589
4-amino-5-chloro-2-methoxy-N-[[1-[4-(methylcarbamothioylamino)butyl]pyrrolidin-3-yl]methyl]benzamide (PubChem CID 54547589) has the molecular formula C19H30ClN5O2S and a molecular weight of 428.00 g/mol. Its IUPAC name is 4-amino-5-chloro-2-methoxy-N-[[1-[4-(methylcarbamothioylamino)butyl]pyrrolidin-3-yl]methyl]benzamide.
| Compound Name | 4-amino-5-chloro-2-methoxy-N-[[1-[4-(methylcarbamothioylamino)butyl]pyrrolidin-3-yl]methyl]benzamide |
|---|---|
| PubChem CID | 54547589 |
| Molecular Formula | C19H30ClN5O2S |
| Molecular Weight | 428.00 g/mol |
| Exact Mass | 427.18 |
| IUPAC Name | 4-amino-5-chloro-2-methoxy-N-[[1-[4-(methylcarbamothioylamino)butyl]pyrrolidin-3-yl]methyl]benzamide |
| SMILES | CNC(=S)NCCCCN1CCC(CNC(=O)c2cc(Cl)c(N)cc2OC)C1 |
| InChI | InChI=1S/C19H30ClN5O2S/c1-22-19(28)23-6-3-4-7-25-8-5-13(12-25)11-24-18(26)14-9-15(20)16(21)10-17(14)27-2/h9-10,13H,3-8,11-12,21H2,1-2H3,(H,24,26)(H2,22,23,28) |
| InChIKey | ZHPQQZQTMJZMMR-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 91.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.00 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|