C27H33ClN4O4 — CID 54379569
4-amino-5-chloro-N-[[1-[5-(1,3-dioxoisoindol-2-yl)pentyl]piperidin-4-yl]methyl]-2-methoxybenzamide (PubChem CID 54379569) has the molecular formula C27H33ClN4O4 and a molecular weight of 513.04 g/mol. Its IUPAC name is 4-amino-5-chloro-N-[[1-[5-(1,3-dioxoisoindol-2-yl)pentyl]piperidin-4-yl]methyl]-2-methoxybenzamide.
| Compound Name | 4-amino-5-chloro-N-[[1-[5-(1,3-dioxoisoindol-2-yl)pentyl]piperidin-4-yl]methyl]-2-methoxybenzamide |
|---|---|
| PubChem CID | 54379569 |
| Molecular Formula | C27H33ClN4O4 |
| Molecular Weight | 513.04 g/mol |
| Exact Mass | 512.22 |
| IUPAC Name | 4-amino-5-chloro-N-[[1-[5-(1,3-dioxoisoindol-2-yl)pentyl]piperidin-4-yl]methyl]-2-methoxybenzamide |
| SMILES | COc1cc(N)c(Cl)cc1C(=O)NCC1CCN(CCCCCN2C(=O)c3ccccc3C2=O)CC1 |
| InChI | InChI=1S/C27H33ClN4O4/c1-36-24-16-23(29)22(28)15-21(24)25(33)30-17-18-9-13-31(14-10-18)11-5-2-6-12-32-26(34)19-7-3-4-8-20(19)27(32)35/h3-4,7-8,15-16,18H,2,5-6,9-14,17,29H2,1H3,(H,30,33) |
| InChIKey | UYYZRUFHIDQQLG-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 104.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.04 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|