C30H40ClN5O3 — CID 54404871
N-[6-[4-[[(4-amino-5-chloro-2-methoxybenzoyl)amino]methyl]piperidin-1-yl]hexyl]-1-methylindole-3-carboxamide (PubChem CID 54404871) has the molecular formula C30H40ClN5O3 and a molecular weight of 554.14 g/mol. Its IUPAC name is N-[6-[4-[[(4-amino-5-chloro-2-methoxybenzoyl)amino]methyl]piperidin-1-yl]hexyl]-1-methylindole-3-carboxamide.
| Compound Name | N-[6-[4-[[(4-amino-5-chloro-2-methoxybenzoyl)amino]methyl]piperidin-1-yl]hexyl]-1-methylindole-3-carboxamide |
|---|---|
| PubChem CID | 54404871 |
| Molecular Formula | C30H40ClN5O3 |
| Molecular Weight | 554.14 g/mol |
| Exact Mass | 553.28 |
| IUPAC Name | N-[6-[4-[[(4-amino-5-chloro-2-methoxybenzoyl)amino]methyl]piperidin-1-yl]hexyl]-1-methylindole-3-carboxamide |
| SMILES | COc1cc(N)c(Cl)cc1C(=O)NCC1CCN(CCCCCCNC(=O)c2cn(C)c3ccccc23)CC1 |
| InChI | InChI=1S/C30H40ClN5O3/c1-35-20-24(22-9-5-6-10-27(22)35)30(38)33-13-7-3-4-8-14-36-15-11-21(12-16-36)19-34-29(37)23-17-25(31)26(32)18-28(23)39-2/h5-6,9-10,17-18,20-21H,3-4,7-8,11-16,19,32H2,1-2H3,(H,33,38)(H,34,37) |
| InChIKey | VPZFNKVZMIAEJK-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 101.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.14 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|