C29H36ClN3O4 — CID 70075432
4-amino-5-chloro-2-methoxy-N-[[1-[6-(2-methyl-1-benzofuran-3-yl)-6-oxohexyl]piperidin-4-yl]methyl]benzamide (PubChem CID 70075432) has the molecular formula C29H36ClN3O4 and a molecular weight of 526.08 g/mol. Its IUPAC name is 4-amino-5-chloro-2-methoxy-N-[[1-[6-(2-methyl-1-benzofuran-3-yl)-6-oxohexyl]piperidin-4-yl]methyl]benzamide.
| Compound Name | 4-amino-5-chloro-2-methoxy-N-[[1-[6-(2-methyl-1-benzofuran-3-yl)-6-oxohexyl]piperidin-4-yl]methyl]benzamide |
|---|---|
| PubChem CID | 70075432 |
| Molecular Formula | C29H36ClN3O4 |
| Molecular Weight | 526.08 g/mol |
| Exact Mass | 525.24 |
| IUPAC Name | 4-amino-5-chloro-2-methoxy-N-[[1-[6-(2-methyl-1-benzofuran-3-yl)-6-oxohexyl]piperidin-4-yl]methyl]benzamide |
| SMILES | COc1cc(N)c(Cl)cc1C(=O)NCC1CCN(CCCCCC(=O)c2c(C)oc3ccccc23)CC1 |
| InChI | InChI=1S/C29H36ClN3O4/c1-19-28(21-8-5-6-10-26(21)37-19)25(34)9-4-3-7-13-33-14-11-20(12-15-33)18-32-29(35)22-16-23(30)24(31)17-27(22)36-2/h5-6,8,10,16-17,20H,3-4,7,9,11-15,18,31H2,1-2H3,(H,32,35) |
| InChIKey | DSZCAXPYOYJSFJ-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 97.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.08 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|