C26H36ClN5O3 — CID 22941690
4-amino-5-chloro-2-methoxy-N-[[(3R)-1-[6-(phenylcarbamoylamino)hexyl]pyrrolidin-3-yl]methyl]benzamide (PubChem CID 22941690) has the molecular formula C26H36ClN5O3 and a molecular weight of 502.06 g/mol. Its IUPAC name is 4-amino-5-chloro-2-methoxy-N-[[(3R)-1-[6-(phenylcarbamoylamino)hexyl]pyrrolidin-3-yl]methyl]benzamide.
| Compound Name | 4-amino-5-chloro-2-methoxy-N-[[(3R)-1-[6-(phenylcarbamoylamino)hexyl]pyrrolidin-3-yl]methyl]benzamide |
|---|---|
| PubChem CID | 22941690 |
| Molecular Formula | C26H36ClN5O3 |
| Molecular Weight | 502.06 g/mol |
| Exact Mass | 501.25 |
| IUPAC Name | 4-amino-5-chloro-2-methoxy-N-[[(3R)-1-[6-(phenylcarbamoylamino)hexyl]pyrrolidin-3-yl]methyl]benzamide |
| SMILES | COc1cc(N)c(Cl)cc1C(=O)NC[C@H]1CCN(CCCCCCNC(=O)Nc2ccccc2)C1 |
| InChI | InChI=1S/C26H36ClN5O3/c1-35-24-16-23(28)22(27)15-21(24)25(33)30-17-19-11-14-32(18-19)13-8-3-2-7-12-29-26(34)31-20-9-5-4-6-10-20/h4-6,9-10,15-16,19H,2-3,7-8,11-14,17-18,28H2,1H3,(H,30,33)(H2,29,31,34)/t19-/m1/s1 |
| InChIKey | JYJTZEGDNDAXEZ-LJQANCHMSA-N |
| XLogP | 4.36 |
| TPSA | 108.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.06 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|