C29H37ClN4O3 — CID 10029792
4-amino-5-chloro-2-methoxy-N-[[1-[6-(1-methylindol-3-yl)-6-oxohexyl]piperidin-4-yl]methyl]benzamide (PubChem CID 10029792) has the molecular formula C29H37ClN4O3 and a molecular weight of 525.09 g/mol. Its IUPAC name is 4-amino-5-chloro-2-methoxy-N-[[1-[6-(1-methylindol-3-yl)-6-oxohexyl]piperidin-4-yl]methyl]benzamide.
| Compound Name | 4-amino-5-chloro-2-methoxy-N-[[1-[6-(1-methylindol-3-yl)-6-oxohexyl]piperidin-4-yl]methyl]benzamide |
|---|---|
| PubChem CID | 10029792 |
| Molecular Formula | C29H37ClN4O3 |
| Molecular Weight | 525.09 g/mol |
| Exact Mass | 524.26 |
| IUPAC Name | 4-amino-5-chloro-2-methoxy-N-[[1-[6-(1-methylindol-3-yl)-6-oxohexyl]piperidin-4-yl]methyl]benzamide |
| SMILES | COc1cc(N)c(Cl)cc1C(=O)NCC1CCN(CCCCCC(=O)c2cn(C)c3ccccc23)CC1 |
| InChI | InChI=1S/C29H37ClN4O3/c1-33-19-23(21-8-5-6-9-26(21)33)27(35)10-4-3-7-13-34-14-11-20(12-15-34)18-32-29(36)22-16-24(30)25(31)17-28(22)37-2/h5-6,8-9,16-17,19-20H,3-4,7,10-15,18,31H2,1-2H3,(H,32,36) |
| InChIKey | RGNWRSIRUUKYSL-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 89.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.09 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|