C25H30ClN5O3 — CID 54330977
N-[2-[3-[[(4-amino-5-chloro-2-methoxybenzoyl)amino]methyl]pyrrolidin-1-yl]ethyl]-1-methylindole-3-carboxamide (PubChem CID 54330977) has the molecular formula C25H30ClN5O3 and a molecular weight of 484.00 g/mol. Its IUPAC name is N-[2-[3-[[(4-amino-5-chloro-2-methoxybenzoyl)amino]methyl]pyrrolidin-1-yl]ethyl]-1-methylindole-3-carboxamide.
| Compound Name | N-[2-[3-[[(4-amino-5-chloro-2-methoxybenzoyl)amino]methyl]pyrrolidin-1-yl]ethyl]-1-methylindole-3-carboxamide |
|---|---|
| PubChem CID | 54330977 |
| Molecular Formula | C25H30ClN5O3 |
| Molecular Weight | 484.00 g/mol |
| Exact Mass | 483.20 |
| IUPAC Name | N-[2-[3-[[(4-amino-5-chloro-2-methoxybenzoyl)amino]methyl]pyrrolidin-1-yl]ethyl]-1-methylindole-3-carboxamide |
| SMILES | COc1cc(N)c(Cl)cc1C(=O)NCC1CCN(CCNC(=O)c2cn(C)c3ccccc23)C1 |
| InChI | InChI=1S/C25H30ClN5O3/c1-30-15-19(17-5-3-4-6-22(17)30)25(33)28-8-10-31-9-7-16(14-31)13-29-24(32)18-11-20(26)21(27)12-23(18)34-2/h3-6,11-12,15-16H,7-10,13-14,27H2,1-2H3,(H,28,33)(H,29,32) |
| InChIKey | SYIAJLAVUDZGBA-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 101.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.00 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|