C31H41ClN4O3 — CID 54560381
4-amino-5-chloro-2-methoxy-N-[[1-[6-oxo-6-(1-propylindol-3-yl)hexyl]piperidin-4-yl]methyl]benzamide (PubChem CID 54560381) has the molecular formula C31H41ClN4O3 and a molecular weight of 553.15 g/mol. Its IUPAC name is 4-amino-5-chloro-2-methoxy-N-[[1-[6-oxo-6-(1-propylindol-3-yl)hexyl]piperidin-4-yl]methyl]benzamide.
| Compound Name | 4-amino-5-chloro-2-methoxy-N-[[1-[6-oxo-6-(1-propylindol-3-yl)hexyl]piperidin-4-yl]methyl]benzamide |
|---|---|
| PubChem CID | 54560381 |
| Molecular Formula | C31H41ClN4O3 |
| Molecular Weight | 553.15 g/mol |
| Exact Mass | 552.29 |
| IUPAC Name | 4-amino-5-chloro-2-methoxy-N-[[1-[6-oxo-6-(1-propylindol-3-yl)hexyl]piperidin-4-yl]methyl]benzamide |
| SMILES | CCCn1cc(C(=O)CCCCCN2CCC(CNC(=O)c3cc(Cl)c(N)cc3OC)CC2)c2ccccc21 |
| InChI | InChI=1S/C31H41ClN4O3/c1-3-14-36-21-25(23-9-6-7-10-28(23)36)29(37)11-5-4-8-15-35-16-12-22(13-17-35)20-34-31(38)24-18-26(32)27(33)19-30(24)39-2/h6-7,9-10,18-19,21-22H,3-5,8,11-17,20,33H2,1-2H3,(H,34,38) |
| InChIKey | ZQDBZETZQBUFBD-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 89.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.15 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|